the following information for the Triaglycerol “Oleooleopalmityl glycerol (Oleooleopalmitin)” chart below. Using the triglyceride that has been assigned to you, determine and present the following information regarding the animal cell's ability to obtain energy from the triglyceride molecule. a. Total number of ATP's that could theoretically be obtained from a complete breakdown (hydrolysis of ester bonds and beta oxidation of each fatty acid [FA]) of the triglyceride. Be sure to follow the molecules through all pertinent aspects of glycolysis, Kreb's cycle, and the electron transport chain (ETC). Also, assume that the cell will obtain 3 ATP's for each NADH entering the ETC and wll obtain 2 ATP's for each FADH, entering the ETC. b. The structural formula for each FA and the total number of carbons in each FA obtained from the hydrolysis of the ester bonds. c. Total number of acetyl CoA's produced through beta oxidation. d. Total number of NADH's produced from the oxidation of the triglyceride (be sure to consider NADH gained or lost from beta oxidation) e. Total number of FADH,'s produced from the oxidation of the triglyceride (be sure to consider the FADH, 's gained or lost from beta oxidation) f. The percent increase or decrease over the theoretical 36 ATP's from 1 molecule of glucose. chart below. Using the triglyceride that has been assigned to you, determine and present the following information regarding the animal cell's ability to obtain energy from the triglyceride molecule. a. Total number of ATP's that could theoretically be obtained from a complete breakdown (hydrolysis of ester bonds and beta oxidation of each fatty acid [FA]) of the triglyceride. Be sure to follow the molecules through all pertinent aspects of glycolysis, Kreb's cycle, and the electron transport chain (ETC). Also, assume that the cell will obtain 3 ATP's for each NADH entering the ETC and wll obtain 2 ATP's for each FADH, entering the ETC. b. The structural formula for each FA and the total number of carbons in each FA obtained from the hydrolysis of the ester bonds. c. Total number of acetyl CoA's produced through beta oxidation. d. Total number of NADH's produced from the oxidation of the triglyceride (be sure to consider NADH gained or lost from beta oxidation) e. Total number of FADH,'s produced from the oxidation of the triglyceride (be sure to consider the FADH, 's gained or lost from beta oxidation) f. The percent increase or decrease over the theoretical 36 ATP's from 1 molecule of glucose.
CH2-O-co-[CH2]15-CH3 | CHO-co-CH3(CH2)7CH=CH(CH2)7COOH | CH2-O-co-CH3(CH2)7CH=CH(CH2)7COOH Activation of the fatty acid to Acyl CoA = -2 ATP Palmitic acid is a 16 carbon fatty acid. Activation of the fatty acid to Acyl CoA = -2 ATP Number of cycles in the Beta oxidation of palmitic acid goes is (16/2) -1 = 7 7 FADH2 = 7 X 2 ATP = 14 ATP 7 NADH = 7 X 3 ATP = 21ATP Beta oxidation 7 cycle gives 8 Acetyl COA enter into TCA cycle In krebs cycle Acetyl CoA oxidation in the Krebs Cycle = 3NADH, 1FADH2, 1GTP 1 FADH2 = 1 X 2 ATP = 2 ATP 3 NADH = 3 X 3 ATP = 9 ATP 1GTP = 1ATP 1 Acetyl COA in TCA cycle provides 12 ATP 8 Acetyl CoA x 12 ATP/Acetyl CoA = 96 ATP Total palmitic acid ATP produces = 14+21+96-2 = 129 ATP Oleic acid has one double bond and it is 18 carbon chain. So one less FADH2 is produced. In these 9 aceyl coA, 7 FADH2 and 8 NADH. Activation of the fatty acid to Acyl CoA = -2 ATP 7 FADH2 = 7 X 2 ATP = 14 ATP 8 NADH = 8 X 3 ATP = 24 ATP 9 Acetyl CoA x 12 ATP/Acetyl CoA = 108 ATP Total oleic acid ATP produces = 14+24+108-2 = 144 ATP So 2 oleic acid gives = 288 ATP. 1 Glycerol gives = 11 + 5 + 19 = 35 ATP Total = 129 + 288 + 35 = 452 ATP